C32H34O8 — CID 10530621
diethyl (4Z)-4-benzylidene-2-phenyl-5-(3,4,5-trimethoxyphenyl)oxolane-3,3-dicarboxylate (PubChem CID 10530621) has the molecular formula C32H34O8 and a molecular weight of 546.62 g/mol. Its IUPAC name is diethyl (4Z)-4-benzylidene-2-phenyl-5-(3,4,5-trimethoxyphenyl)oxolane-3,3-dicarboxylate.
| Compound Name | diethyl (4Z)-4-benzylidene-2-phenyl-5-(3,4,5-trimethoxyphenyl)oxolane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 10530621 |
| Molecular Formula | C32H34O8 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | diethyl (4Z)-4-benzylidene-2-phenyl-5-(3,4,5-trimethoxyphenyl)oxolane-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)/C(=C/c2ccccc2)C(c2cc(OC)c(OC)c(OC)c2)OC1c1ccccc1 |
| InChI | InChI=1S/C32H34O8/c1-6-38-30(33)32(31(34)39-7-2)24(18-21-14-10-8-11-15-21)27(40-29(32)22-16-12-9-13-17-22)23-19-25(35-3)28(37-5)26(20-23)36-4/h8-20,27,29H,6-7H2,1-5H3/b24-18+ |
| InChIKey | DRFJHZBTQZGNPQ-HKOYGPOVSA-N |
| XLogP | 5.72 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|