C32H32O9 — CID 71723678
diethyl (2S,4S,5S)-2-(4-acetyloxy-3-methoxyphenyl)-4-benzoyl-5-phenyloxolane-3,3-dicarboxylate (PubChem CID 71723678) has the molecular formula C32H32O9 and a molecular weight of 560.60 g/mol. Its IUPAC name is diethyl (2S,4S,5S)-2-(4-acetyloxy-3-methoxyphenyl)-4-benzoyl-5-phenyloxolane-3,3-dicarboxylate.
| Compound Name | diethyl (2S,4S,5S)-2-(4-acetyloxy-3-methoxyphenyl)-4-benzoyl-5-phenyloxolane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 71723678 |
| Molecular Formula | C32H32O9 |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | diethyl (2S,4S,5S)-2-(4-acetyloxy-3-methoxyphenyl)-4-benzoyl-5-phenyloxolane-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H](C(=O)c2ccccc2)[C@@H](c2ccccc2)O[C@H]1c1ccc(OC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C32H32O9/c1-5-38-30(35)32(31(36)39-6-2)26(27(34)21-13-9-7-10-14-21)28(22-15-11-8-12-16-22)41-29(32)23-17-18-24(40-20(3)33)25(19-23)37-4/h7-19,26,28-29H,5-6H2,1-4H3/t26-,28-,29+/m1/s1 |
| InChIKey | IHCBRKCXEDNMMG-CMYDWJSCSA-N |
| XLogP | 5.04 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|