C31H34O7 — CID 132571858
trans-diethyl (2R,4S)-4-(3,4-dimethoxyphenyl)-2-hydroxy-3,3-diphenylcyclopentane-1,1-dicarboxylate (PubChem CID 132571858) has the molecular formula C31H34O7 and a molecular weight of 518.61 g/mol. Its IUPAC name is trans-diethyl (2R,4S)-4-(3,4-dimethoxyphenyl)-2-hydroxy-3,3-diphenylcyclopentane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (2R,4S)-4-(3,4-dimethoxyphenyl)-2-hydroxy-3,3-diphenylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 132571858 |
| Molecular Formula | C31H34O7 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | trans-diethyl (2R,4S)-4-(3,4-dimethoxyphenyl)-2-hydroxy-3,3-diphenylcyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H](c2ccc(OC)c(OC)c2)C(c2ccccc2)(c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C31H34O7/c1-5-37-28(33)30(29(34)38-6-2)20-24(21-17-18-25(35-3)26(19-21)36-4)31(27(30)32,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-19,24,27,32H,5-6,20H2,1-4H3/t24-,27-/m0/s1 |
| InChIKey | HOGUZQORLSDNKY-IGKIAQTJSA-N |
| XLogP | 4.65 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|