C24H29NO7 — CID 13248012
ethyl 4-(3,4-dimethoxyphenyl)-3-[(3,4-dimethoxyphenyl)methyl]-2-oxopyrrolidine-3-carboxylate (PubChem CID 13248012) has the molecular formula C24H29NO7 and a molecular weight of 443.50 g/mol. Its IUPAC name is ethyl 4-(3,4-dimethoxyphenyl)-3-[(3,4-dimethoxyphenyl)methyl]-2-oxopyrrolidine-3-carboxylate.
| Compound Name | ethyl 4-(3,4-dimethoxyphenyl)-3-[(3,4-dimethoxyphenyl)methyl]-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 13248012 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | ethyl 4-(3,4-dimethoxyphenyl)-3-[(3,4-dimethoxyphenyl)methyl]-2-oxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccc(OC)c(OC)c2)C(=O)NCC1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H29NO7/c1-6-32-23(27)24(13-15-7-9-18(28-2)20(11-15)30-4)17(14-25-22(24)26)16-8-10-19(29-3)21(12-16)31-5/h7-12,17H,6,13-14H2,1-5H3,(H,25,26) |
| InChIKey | LWMOHBFUJHFATK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|