C22H32NO10P — CID 102494182
diethyl (3S,4R)-4-diethoxyphosphoryl-3-(3,4-dimethoxyphenyl)-5-oxopyrrolidine-2,2-dicarboxylate (PubChem CID 102494182) has the molecular formula C22H32NO10P and a molecular weight of 501.47 g/mol. Its IUPAC name is diethyl (3S,4R)-4-diethoxyphosphoryl-3-(3,4-dimethoxyphenyl)-5-oxopyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl (3S,4R)-4-diethoxyphosphoryl-3-(3,4-dimethoxyphenyl)-5-oxopyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102494182 |
| Molecular Formula | C22H32NO10P |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | diethyl (3S,4R)-4-diethoxyphosphoryl-3-(3,4-dimethoxyphenyl)-5-oxopyrrolidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)NC(=O)[C@H](P(=O)(OCC)OCC)[C@H]1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H32NO10P/c1-7-30-20(25)22(21(26)31-8-2)17(14-11-12-15(28-5)16(13-14)29-6)18(19(24)23-22)34(27,32-9-3)33-10-4/h11-13,17-18H,7-10H2,1-6H3,(H,23,24)/t17-,18-/m1/s1 |
| InChIKey | CGTBZEGZCIEVKL-QZTJIDSGSA-N |
| XLogP | 2.42 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|