C20H27N2O10P — CID 102494183
diethyl (3S,4R)-4-diethoxyphosphoryl-3-(4-nitrophenyl)-5-oxopyrrolidine-2,2-dicarboxylate (PubChem CID 102494183) has the molecular formula C20H27N2O10P and a molecular weight of 486.41 g/mol. Its IUPAC name is diethyl (3S,4R)-4-diethoxyphosphoryl-3-(4-nitrophenyl)-5-oxopyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl (3S,4R)-4-diethoxyphosphoryl-3-(4-nitrophenyl)-5-oxopyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102494183 |
| Molecular Formula | C20H27N2O10P |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | diethyl (3S,4R)-4-diethoxyphosphoryl-3-(4-nitrophenyl)-5-oxopyrrolidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)NC(=O)[C@H](P(=O)(OCC)OCC)[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H27N2O10P/c1-5-29-18(24)20(19(25)30-6-2)15(13-9-11-14(12-10-13)22(26)27)16(17(23)21-20)33(28,31-7-3)32-8-4/h9-12,15-16H,5-8H2,1-4H3,(H,21,23)/t15-,16-/m1/s1 |
| InChIKey | WFSMYZQITUAVRS-HZPDHXFCSA-N |
| XLogP | 2.31 |
| TPSA | 160.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|