C13H18NO5P — CID 102133820
1-[(1R,2S)-2-diethoxyphosphorylcyclopropyl]-4-nitrobenzene (PubChem CID 102133820) has the molecular formula C13H18NO5P and a molecular weight of 299.26 g/mol. Its IUPAC name is 1-[(1R,2S)-2-diethoxyphosphorylcyclopropyl]-4-nitrobenzene.
| Compound Name | 1-[(1R,2S)-2-diethoxyphosphorylcyclopropyl]-4-nitrobenzene |
|---|---|
| PubChem CID | 102133820 |
| Molecular Formula | C13H18NO5P |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-[(1R,2S)-2-diethoxyphosphorylcyclopropyl]-4-nitrobenzene |
| SMILES | CCOP(=O)(OCC)[C@H]1C[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H18NO5P/c1-3-18-20(17,19-4-2)13-9-12(13)10-5-7-11(8-6-10)14(15)16/h5-8,12-13H,3-4,9H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | UBTJATMJBBSUMT-OLZOCXBDSA-N |
| XLogP | 3.72 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|