C19H28NO5PS3 — CID 101062437
(2S,4R)-5-diethoxyphosphoryl-2,6-bis(ethylsulfanyl)-4-(4-nitrophenyl)-3,4-dihydro-2H-thiopyran (PubChem CID 101062437) has the molecular formula C19H28NO5PS3 and a molecular weight of 477.61 g/mol. Its IUPAC name is (2S,4R)-5-diethoxyphosphoryl-2,6-bis(ethylsulfanyl)-4-(4-nitrophenyl)-3,4-dihydro-2H-thiopyran.
| Compound Name | (2S,4R)-5-diethoxyphosphoryl-2,6-bis(ethylsulfanyl)-4-(4-nitrophenyl)-3,4-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 101062437 |
| Molecular Formula | C19H28NO5PS3 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | (2S,4R)-5-diethoxyphosphoryl-2,6-bis(ethylsulfanyl)-4-(4-nitrophenyl)-3,4-dihydro-2H-thiopyran |
| SMILES | CCOP(=O)(OCC)C1=C(SCC)S[C@H](SCC)C[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H28NO5PS3/c1-5-24-26(23,25-6-2)18-16(14-9-11-15(12-10-14)20(21)22)13-17(27-7-3)29-19(18)28-8-4/h9-12,16-17H,5-8,13H2,1-4H3/t16-,17+/m1/s1 |
| InChIKey | FVSSWLYBJMOGME-SJORKVTESA-N |
| XLogP | 7.08 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|