C16H22NO7P — CID 85180320
5-dimethoxyphosphoryl-2-ethoxy-6-methyl-4-(4-nitrophenyl)-3,4-dihydro-2H-pyran (PubChem CID 85180320) has the molecular formula C16H22NO7P and a molecular weight of 371.33 g/mol. Its IUPAC name is 5-dimethoxyphosphoryl-2-ethoxy-6-methyl-4-(4-nitrophenyl)-3,4-dihydro-2H-pyran.
| Compound Name | 5-dimethoxyphosphoryl-2-ethoxy-6-methyl-4-(4-nitrophenyl)-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 85180320 |
| Molecular Formula | C16H22NO7P |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 5-dimethoxyphosphoryl-2-ethoxy-6-methyl-4-(4-nitrophenyl)-3,4-dihydro-2H-pyran |
| SMILES | CCOC1CC(c2ccc([N+](=O)[O-])cc2)C(P(=O)(OC)OC)=C(C)O1 |
| InChI | InChI=1S/C16H22NO7P/c1-5-23-15-10-14(12-6-8-13(9-7-12)17(18)19)16(11(2)24-15)25(20,21-3)22-4/h6-9,14-15H,5,10H2,1-4H3 |
| InChIKey | JEFGQNQQLWNXQY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|