C18H23NO6 — CID 53391772
methyl (2S,4S)-2-butoxy-6-methyl-4-(4-nitrophenyl)-3,4-dihydro-2H-pyran-5-carboxylate (PubChem CID 53391772) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is methyl (2S,4S)-2-butoxy-6-methyl-4-(4-nitrophenyl)-3,4-dihydro-2H-pyran-5-carboxylate.
| Compound Name | methyl (2S,4S)-2-butoxy-6-methyl-4-(4-nitrophenyl)-3,4-dihydro-2H-pyran-5-carboxylate |
|---|---|
| PubChem CID | 53391772 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | methyl (2S,4S)-2-butoxy-6-methyl-4-(4-nitrophenyl)-3,4-dihydro-2H-pyran-5-carboxylate |
| SMILES | CCCCO[C@@H]1C[C@@H](c2ccc([N+](=O)[O-])cc2)C(C(=O)OC)=C(C)O1 |
| InChI | InChI=1S/C18H23NO6/c1-4-5-10-24-16-11-15(17(12(2)25-16)18(20)23-3)13-6-8-14(9-7-13)19(21)22/h6-9,15-16H,4-5,10-11H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | NZJIJXBABJKKPH-HOTGVXAUSA-N |
| XLogP | 3.69 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|