C19H16N2O5 — CID 139093669
methyl (3S,4aR)-3-(4-nitrophenyl)-4,4a-dihydro-3H-pyrido[2,1-b][1,3]benzoxazole-2-carboxylate (PubChem CID 139093669) has the molecular formula C19H16N2O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is methyl (3S,4aR)-3-(4-nitrophenyl)-4,4a-dihydro-3H-pyrido[2,1-b][1,3]benzoxazole-2-carboxylate.
| Compound Name | methyl (3S,4aR)-3-(4-nitrophenyl)-4,4a-dihydro-3H-pyrido[2,1-b][1,3]benzoxazole-2-carboxylate |
|---|---|
| PubChem CID | 139093669 |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | methyl (3S,4aR)-3-(4-nitrophenyl)-4,4a-dihydro-3H-pyrido[2,1-b][1,3]benzoxazole-2-carboxylate |
| SMILES | COC(=O)C1=CN2c3ccccc3O[C@@H]2C[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H16N2O5/c1-25-19(22)15-11-20-16-4-2-3-5-17(16)26-18(20)10-14(15)12-6-8-13(9-7-12)21(23)24/h2-9,11,14,18H,10H2,1H3/t14-,18+/m0/s1 |
| InChIKey | VINHFWRYZIZJBR-KBXCAEBGSA-N |
| XLogP | 3.36 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|