C32H28N4O6 — CID 102193044
methyl (2S,3R,6R)-4-anilino-3-methyl-2,6-bis(4-nitrophenyl)-1-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 102193044) has the molecular formula C32H28N4O6 and a molecular weight of 564.60 g/mol. Its IUPAC name is methyl (2S,3R,6R)-4-anilino-3-methyl-2,6-bis(4-nitrophenyl)-1-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | methyl (2S,3R,6R)-4-anilino-3-methyl-2,6-bis(4-nitrophenyl)-1-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 102193044 |
| Molecular Formula | C32H28N4O6 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | methyl (2S,3R,6R)-4-anilino-3-methyl-2,6-bis(4-nitrophenyl)-1-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccccc2)[C@H](C)[C@@H](c2ccc([N+](=O)[O-])cc2)N(c2ccccc2)[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H28N4O6/c1-21-29(33-24-9-5-3-6-10-24)28(32(37)42-2)31(23-15-19-27(20-16-23)36(40)41)34(25-11-7-4-8-12-25)30(21)22-13-17-26(18-14-22)35(38)39/h3-21,30-31,33H,1-2H3/t21-,30-,31+/m0/s1 |
| InChIKey | LXNCPQNZDRDCRZ-JDRLREMTSA-N |
| XLogP | 6.98 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|