C25H22N2O5 — CID 101242664
methyl (2R,5S)-2-(4-methoxyphenyl)-1-(4-nitrophenyl)-5-phenyl-2,5-dihydropyrrole-3-carboxylate (PubChem CID 101242664) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is methyl (2R,5S)-2-(4-methoxyphenyl)-1-(4-nitrophenyl)-5-phenyl-2,5-dihydropyrrole-3-carboxylate.
| Compound Name | methyl (2R,5S)-2-(4-methoxyphenyl)-1-(4-nitrophenyl)-5-phenyl-2,5-dihydropyrrole-3-carboxylate |
|---|---|
| PubChem CID | 101242664 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | methyl (2R,5S)-2-(4-methoxyphenyl)-1-(4-nitrophenyl)-5-phenyl-2,5-dihydropyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](c2ccccc2)N(c2ccc([N+](=O)[O-])cc2)[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H22N2O5/c1-31-21-14-8-18(9-15-21)24-22(25(28)32-2)16-23(17-6-4-3-5-7-17)26(24)19-10-12-20(13-11-19)27(29)30/h3-16,23-24H,1-2H3/t23-,24+/m0/s1 |
| InChIKey | ZULXKFZXJPLXHB-BJKOFHAPSA-N |
| XLogP | 5.01 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|