C25H26N4O7 — CID 132509108
methyl (1R,2R,7S)-7-(4-nitrophenyl)-3-oxo-2-(phenylmethoxycarbonylamino)-1-propan-2-yl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate (PubChem CID 132509108) has the molecular formula C25H26N4O7 and a molecular weight of 494.50 g/mol. Its IUPAC name is methyl (1R,2R,7S)-7-(4-nitrophenyl)-3-oxo-2-(phenylmethoxycarbonylamino)-1-propan-2-yl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate.
| Compound Name | methyl (1R,2R,7S)-7-(4-nitrophenyl)-3-oxo-2-(phenylmethoxycarbonylamino)-1-propan-2-yl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate |
|---|---|
| PubChem CID | 132509108 |
| Molecular Formula | C25H26N4O7 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | methyl (1R,2R,7S)-7-(4-nitrophenyl)-3-oxo-2-(phenylmethoxycarbonylamino)-1-propan-2-yl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-6-carboxylate |
| SMILES | COC(=O)C1=CN2C(=O)[C@H](NC(=O)OCc3ccccc3)[C@@H](C(C)C)N2[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H26N4O7/c1-15(2)21-20(26-25(32)36-14-16-7-5-4-6-8-16)23(30)27-13-19(24(31)35-3)22(28(21)27)17-9-11-18(12-10-17)29(33)34/h4-13,15,20-22H,14H2,1-3H3,(H,26,32)/t20-,21-,22+/m1/s1 |
| InChIKey | RAEYGCRLPDVKRL-VSKRKVRLSA-N |
| XLogP | 3.09 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|