C25H23N3O12 — CID 67901966
methyl (4S,5S)-2-[2-[(4-nitrophenyl)methoxycarbonyl]-5-oxooxolan-2-yl]-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidine-5-carboxylate (PubChem CID 67901966) has the molecular formula C25H23N3O12 and a molecular weight of 557.47 g/mol. Its IUPAC name is methyl (4S,5S)-2-[2-[(4-nitrophenyl)methoxycarbonyl]-5-oxooxolan-2-yl]-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidine-5-carboxylate.
| Compound Name | methyl (4S,5S)-2-[2-[(4-nitrophenyl)methoxycarbonyl]-5-oxooxolan-2-yl]-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidine-5-carboxylate |
|---|---|
| PubChem CID | 67901966 |
| Molecular Formula | C25H23N3O12 |
| Molecular Weight | 557.47 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | methyl (4S,5S)-2-[2-[(4-nitrophenyl)methoxycarbonyl]-5-oxooxolan-2-yl]-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidine-5-carboxylate |
| SMILES | COC(=O)[C@H]1ON(C2(C(=O)OCc3ccc([N+](=O)[O-])cc3)CCC(=O)O2)C(=O)[C@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H23N3O12/c1-36-22(31)20-19(26-24(33)38-14-15-5-3-2-4-6-15)21(30)27(40-20)25(12-11-18(29)39-25)23(32)37-13-16-7-9-17(10-8-16)28(34)35/h2-10,19-20H,11-14H2,1H3,(H,26,33)/t19-,20-,25?/m0/s1 |
| InChIKey | OOCVTRZRSZBOPY-QGGGIAGFSA-N |
| XLogP | 1.28 |
| TPSA | 189.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.47 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|