C23H21N3O10 — CID 14798654
(4-nitrophenyl)methyl 5-oxo-2-[(4S)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl]oxolane-2-carboxylate (PubChem CID 14798654) has the molecular formula C23H21N3O10 and a molecular weight of 499.43 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 5-oxo-2-[(4S)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl]oxolane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 5-oxo-2-[(4S)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl]oxolane-2-carboxylate |
|---|---|
| PubChem CID | 14798654 |
| Molecular Formula | C23H21N3O10 |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | (4-nitrophenyl)methyl 5-oxo-2-[(4S)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl]oxolane-2-carboxylate |
| SMILES | O=C1CCC(C(=O)OCc2ccc([N+](=O)[O-])cc2)(N2OC[C@H](NC(=O)OCc3ccccc3)C2=O)O1 |
| InChI | InChI=1S/C23H21N3O10/c27-19-10-11-23(36-19,21(29)33-12-16-6-8-17(9-7-16)26(31)32)25-20(28)18(14-35-25)24-22(30)34-13-15-4-2-1-3-5-15/h1-9,18H,10-14H2,(H,24,30)/t18-,23?/m0/s1 |
| InChIKey | XPVBVMXYLIKOTB-XNUZUHMRSA-N |
| XLogP | 1.74 |
| TPSA | 163.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|