C24H23N3O10 — CID 70428953
(4-nitrophenyl)methyl 5-oxo-2-[(4S)-3-oxo-4-(phenylmethoxycarbonylamino)oxazinan-2-yl]oxolane-2-carboxylate (PubChem CID 70428953) has the molecular formula C24H23N3O10 and a molecular weight of 513.46 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 5-oxo-2-[(4S)-3-oxo-4-(phenylmethoxycarbonylamino)oxazinan-2-yl]oxolane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 5-oxo-2-[(4S)-3-oxo-4-(phenylmethoxycarbonylamino)oxazinan-2-yl]oxolane-2-carboxylate |
|---|---|
| PubChem CID | 70428953 |
| Molecular Formula | C24H23N3O10 |
| Molecular Weight | 513.46 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | (4-nitrophenyl)methyl 5-oxo-2-[(4S)-3-oxo-4-(phenylmethoxycarbonylamino)oxazinan-2-yl]oxolane-2-carboxylate |
| SMILES | O=C1CCC(C(=O)OCc2ccc([N+](=O)[O-])cc2)(N2OCC[C@H](NC(=O)OCc3ccccc3)C2=O)O1 |
| InChI | InChI=1S/C24H23N3O10/c28-20-10-12-24(37-20,22(30)34-14-17-6-8-18(9-7-17)27(32)33)26-21(29)19(11-13-36-26)25-23(31)35-15-16-4-2-1-3-5-16/h1-9,19H,10-15H2,(H,25,31)/t19-,24?/m0/s1 |
| InChIKey | PQCLHBMOSJPHDI-XGLRFROISA-N |
| XLogP | 2.13 |
| TPSA | 163.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|