C30H27N3O10 — CID 67902542
(4-nitrophenyl)methyl 4-benzyl-5-oxo-2-[(4S)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl]oxolane-2-carboxylate (PubChem CID 67902542) has the molecular formula C30H27N3O10 and a molecular weight of 589.56 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-benzyl-5-oxo-2-[(4S)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl]oxolane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 4-benzyl-5-oxo-2-[(4S)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl]oxolane-2-carboxylate |
|---|---|
| PubChem CID | 67902542 |
| Molecular Formula | C30H27N3O10 |
| Molecular Weight | 589.56 g/mol |
| Exact Mass | 589.17 |
| IUPAC Name | (4-nitrophenyl)methyl 4-benzyl-5-oxo-2-[(4S)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl]oxolane-2-carboxylate |
| SMILES | O=C(N[C@H]1CON(C2(C(=O)OCc3ccc([N+](=O)[O-])cc3)CC(Cc3ccccc3)C(=O)O2)C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H27N3O10/c34-26-25(31-29(37)41-18-21-9-5-2-6-10-21)19-42-32(26)30(16-23(27(35)43-30)15-20-7-3-1-4-8-20)28(36)40-17-22-11-13-24(14-12-22)33(38)39/h1-14,23,25H,15-19H2,(H,31,37)/t23?,25-,30?/m0/s1 |
| InChIKey | ZHYOGNPMTOHTSH-ALHPXQGGSA-N |
| XLogP | 3.21 |
| TPSA | 163.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|