C31H28N4O11 — CID 67905971
benzhydryl 2-[(4S)-4-[(2-aminoacetyl)-[(4-nitrophenyl)methoxycarbonyl]amino]-3-oxo-1,2-oxazolidin-2-yl]-5-oxooxolane-2-carboxylate (PubChem CID 67905971) has the molecular formula C31H28N4O11 and a molecular weight of 632.58 g/mol. Its IUPAC name is benzhydryl 2-[(4S)-4-[(2-aminoacetyl)-[(4-nitrophenyl)methoxycarbonyl]amino]-3-oxo-1,2-oxazolidin-2-yl]-5-oxooxolane-2-carboxylate.
| Compound Name | benzhydryl 2-[(4S)-4-[(2-aminoacetyl)-[(4-nitrophenyl)methoxycarbonyl]amino]-3-oxo-1,2-oxazolidin-2-yl]-5-oxooxolane-2-carboxylate |
|---|---|
| PubChem CID | 67905971 |
| Molecular Formula | C31H28N4O11 |
| Molecular Weight | 632.58 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | benzhydryl 2-[(4S)-4-[(2-aminoacetyl)-[(4-nitrophenyl)methoxycarbonyl]amino]-3-oxo-1,2-oxazolidin-2-yl]-5-oxooxolane-2-carboxylate |
| SMILES | NCC(=O)N(C(=O)OCc1ccc([N+](=O)[O-])cc1)[C@H]1CON(C2(C(=O)OC(c3ccccc3)c3ccccc3)CCC(=O)O2)C1=O |
| InChI | InChI=1S/C31H28N4O11/c32-17-25(36)33(30(40)43-18-20-11-13-23(14-12-20)35(41)42)24-19-44-34(28(24)38)31(16-15-26(37)46-31)29(39)45-27(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-14,24,27H,15-19,32H2/t24-,31?/m0/s1 |
| InChIKey | UKFBHTLUKWJLBN-ACXKHFGCSA-N |
| XLogP | 2.53 |
| TPSA | 197.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.58 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|