C30H28N4O8S — CID 70636784
benzhydryl (6R)-7-acetamido-3-[(4-nitrophenyl)methoxycarbonylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 70636784) has the molecular formula C30H28N4O8S and a molecular weight of 604.64 g/mol. Its IUPAC name is benzhydryl (6R)-7-acetamido-3-[(4-nitrophenyl)methoxycarbonylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | benzhydryl (6R)-7-acetamido-3-[(4-nitrophenyl)methoxycarbonylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 70636784 |
| Molecular Formula | C30H28N4O8S |
| Molecular Weight | 604.64 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | benzhydryl (6R)-7-acetamido-3-[(4-nitrophenyl)methoxycarbonylamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | CC(=O)NC1C(=O)N2CC(NC(=O)OCc3ccc([N+](=O)[O-])cc3)(C(=O)OC(c3ccccc3)c3ccccc3)CS[C@H]12 |
| InChI | InChI=1S/C30H28N4O8S/c1-19(35)31-24-26(36)33-17-30(18-43-27(24)33,32-29(38)41-16-20-12-14-23(15-13-20)34(39)40)28(37)42-25(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-15,24-25,27H,16-18H2,1H3,(H,31,35)(H,32,38)/t24?,27-,30?/m1/s1 |
| InChIKey | DDVKWMHKDRMVAR-YNRGKGSCSA-N |
| XLogP | 3.31 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.64 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|