C23H23N3O9S2 — CID 88646116
(4-nitrophenyl)methyl (6R)-3-methylsulfonyloxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 88646116) has the molecular formula C23H23N3O9S2 and a molecular weight of 549.58 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-3-methylsulfonyloxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-3-methylsulfonyloxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 88646116 |
| Molecular Formula | C23H23N3O9S2 |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-3-methylsulfonyloxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | CS(=O)(=O)OC1(C(=O)OCc2ccc([N+](=O)[O-])cc2)CS[C@@H]2C(NC(=O)Cc3ccccc3)C(=O)N2C1 |
| InChI | InChI=1S/C23H23N3O9S2/c1-37(32,33)35-23(22(29)34-12-16-7-9-17(10-8-16)26(30)31)13-25-20(28)19(21(25)36-14-23)24-18(27)11-15-5-3-2-4-6-15/h2-10,19,21H,11-14H2,1H3,(H,24,27)/t19?,21-,23?/m1/s1 |
| InChIKey | NGJCPMQTXKPARP-YUVVGHDESA-N |
| XLogP | 1.00 |
| TPSA | 162.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|