C21H19N3O6S — CID 139675440
(4-nitrophenyl)methyl (3S,5R,6R)-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate (PubChem CID 139675440) has the molecular formula C21H19N3O6S and a molecular weight of 441.47 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (3S,5R,6R)-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (3S,5R,6R)-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 139675440 |
| Molecular Formula | C21H19N3O6S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | (4-nitrophenyl)methyl (3S,5R,6R)-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate |
| SMILES | O=C(Cc1ccccc1)N[C@@H]1C(=O)N2C[C@@H](C(=O)OCc3ccc([N+](=O)[O-])cc3)S[C@H]12 |
| InChI | InChI=1S/C21H19N3O6S/c25-17(10-13-4-2-1-3-5-13)22-18-19(26)23-11-16(31-20(18)23)21(27)30-12-14-6-8-15(9-7-14)24(28)29/h1-9,16,18,20H,10-12H2,(H,22,25)/t16-,18+,20+/m0/s1 |
| InChIKey | YYYWZLFAPMGSFB-ILZDJORESA-N |
| XLogP | 1.65 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|