C21H19N3O8S — CID 70425352
(4-nitrophenyl)methyl (5R)-4,4,7-trioxo-6-[(2-phenylacetyl)amino]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70425352) has the molecular formula C21H19N3O8S and a molecular weight of 473.46 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R)-4,4,7-trioxo-6-[(2-phenylacetyl)amino]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R)-4,4,7-trioxo-6-[(2-phenylacetyl)amino]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70425352 |
| Molecular Formula | C21H19N3O8S |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | (4-nitrophenyl)methyl (5R)-4,4,7-trioxo-6-[(2-phenylacetyl)amino]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | O=C(Cc1ccccc1)NC1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)CS(=O)(=O)[C@H]12 |
| InChI | InChI=1S/C21H19N3O8S/c25-17(10-13-4-2-1-3-5-13)22-18-19(26)23-16(12-33(30,31)20(18)23)21(27)32-11-14-6-8-15(9-7-14)24(28)29/h1-9,16,18,20H,10-12H2,(H,22,25)/t16?,18?,20-/m1/s1 |
| InChIKey | LNEBYSOXVJTSFL-OUNSHVDWSA-N |
| XLogP | 0.33 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|