C23H23N3O8S — CID 14193462
(2R,3S)-1-[3-methyl-1-[(4-nitrophenyl)methoxy]-1-oxobut-2-en-2-yl]-4-oxo-3-[(2-phenylacetyl)amino]azetidine-2-sulfinic acid (PubChem CID 14193462) has the molecular formula C23H23N3O8S and a molecular weight of 501.52 g/mol. Its IUPAC name is (2R,3S)-1-[3-methyl-1-[(4-nitrophenyl)methoxy]-1-oxobut-2-en-2-yl]-4-oxo-3-[(2-phenylacetyl)amino]azetidine-2-sulfinic acid.
| Compound Name | (2R,3S)-1-[3-methyl-1-[(4-nitrophenyl)methoxy]-1-oxobut-2-en-2-yl]-4-oxo-3-[(2-phenylacetyl)amino]azetidine-2-sulfinic acid |
|---|---|
| PubChem CID | 14193462 |
| Molecular Formula | C23H23N3O8S |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | (2R,3S)-1-[3-methyl-1-[(4-nitrophenyl)methoxy]-1-oxobut-2-en-2-yl]-4-oxo-3-[(2-phenylacetyl)amino]azetidine-2-sulfinic acid |
| SMILES | CC(C)=C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)[C@H](NC(=O)Cc2ccccc2)[C@H]1S(=O)O |
| InChI | InChI=1S/C23H23N3O8S/c1-14(2)20(23(29)34-13-16-8-10-17(11-9-16)26(30)31)25-21(28)19(22(25)35(32)33)24-18(27)12-15-6-4-3-5-7-15/h3-11,19,22H,12-13H2,1-2H3,(H,24,27)(H,32,33)/t19-,22+/m0/s1 |
| InChIKey | AWIIBKKSDGSSOE-SIKLNZKXSA-N |
| XLogP | 2.05 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|