C28H29N3O10S — CID 22770433
(4-nitrophenyl)methyl 2-[3-[(2-formyloxy-2-phenylacetyl)amino]-2-(3-methoxy-3-oxopropyl)sulfanyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 22770433) has the molecular formula C28H29N3O10S and a molecular weight of 599.62 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[3-[(2-formyloxy-2-phenylacetyl)amino]-2-(3-methoxy-3-oxopropyl)sulfanyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | (4-nitrophenyl)methyl 2-[3-[(2-formyloxy-2-phenylacetyl)amino]-2-(3-methoxy-3-oxopropyl)sulfanyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 22770433 |
| Molecular Formula | C28H29N3O10S |
| Molecular Weight | 599.62 g/mol |
| Exact Mass | 599.16 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[3-[(2-formyloxy-2-phenylacetyl)amino]-2-(3-methoxy-3-oxopropyl)sulfanyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | COC(=O)CCSC1C(NC(=O)C(OC=O)c2ccccc2)C(=O)N1C(C(=O)OCc1ccc([N+](=O)[O-])cc1)=C(C)C |
| InChI | InChI=1S/C28H29N3O10S/c1-17(2)23(28(36)40-15-18-9-11-20(12-10-18)31(37)38)30-26(35)22(27(30)42-14-13-21(33)39-3)29-25(34)24(41-16-32)19-7-5-4-6-8-19/h4-12,16,22,24,27H,13-15H2,1-3H3,(H,29,34) |
| InChIKey | MDGXCJOXEPNMCK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 171.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.62 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|