C33H31N3O11S — CID 86753536
(4-nitrophenyl)methyl 3-methyl-2-[(3S,4R)-3-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-2-oxo-4-(2-oxo-2-phenylsulfanylethyl)azetidin-1-yl]but-2-enoate (PubChem CID 86753536) has the molecular formula C33H31N3O11S and a molecular weight of 677.69 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-methyl-2-[(3S,4R)-3-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-2-oxo-4-(2-oxo-2-phenylsulfanylethyl)azetidin-1-yl]but-2-enoate.
| Compound Name | (4-nitrophenyl)methyl 3-methyl-2-[(3S,4R)-3-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-2-oxo-4-(2-oxo-2-phenylsulfanylethyl)azetidin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 86753536 |
| Molecular Formula | C33H31N3O11S |
| Molecular Weight | 677.69 g/mol |
| Exact Mass | 677.17 |
| IUPAC Name | (4-nitrophenyl)methyl 3-methyl-2-[(3S,4R)-3-[(1R)-1-[(4-nitrophenyl)methoxycarbonyloxy]ethyl]-2-oxo-4-(2-oxo-2-phenylsulfanylethyl)azetidin-1-yl]but-2-enoate |
| SMILES | CC(C)=C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)[C@H]([C@@H](C)OC(=O)OCc2ccc([N+](=O)[O-])cc2)[C@H]1CC(=O)Sc1ccccc1 |
| InChI | InChI=1S/C33H31N3O11S/c1-20(2)30(32(39)45-18-22-9-13-24(14-10-22)35(41)42)34-27(17-28(37)48-26-7-5-4-6-8-26)29(31(34)38)21(3)47-33(40)46-19-23-11-15-25(16-12-23)36(43)44/h4-16,21,27,29H,17-19H2,1-3H3/t21-,27-,29-/m1/s1 |
| InChIKey | FLWPTCJPYDHHJJ-IABVXZKGSA-N |
| XLogP | 6.12 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.69 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|