C34H31N2O7PS — CID 88695989
(4-nitrophenyl)methyl 2-[3-(1-acetyloxyethyl)-2-oxo-4-sulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 88695989) has the molecular formula C34H31N2O7PS and a molecular weight of 642.67 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[3-(1-acetyloxyethyl)-2-oxo-4-sulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | (4-nitrophenyl)methyl 2-[3-(1-acetyloxyethyl)-2-oxo-4-sulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 88695989 |
| Molecular Formula | C34H31N2O7PS |
| Molecular Weight | 642.67 g/mol |
| Exact Mass | 642.16 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[3-(1-acetyloxyethyl)-2-oxo-4-sulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | CC(=O)OC(C)C1C(=O)N(C(C(=O)OCc2ccc([N+](=O)[O-])cc2)=P(c2ccccc2)(c2ccccc2)c2ccccc2)C1S |
| InChI | InChI=1S/C34H31N2O7PS/c1-23(43-24(2)37)30-31(38)35(33(30)45)32(34(39)42-22-25-18-20-26(21-19-25)36(40)41)44(27-12-6-3-7-13-27,28-14-8-4-9-15-28)29-16-10-5-11-17-29/h3-21,23,30,33,45H,22H2,1-2H3 |
| InChIKey | KQPNQWRYPHOCBJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.67 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|