C36H29N4O5PS — CID 20545038
(4-nitrophenyl)methyl 2-[2-oxo-4-(2-pyrimidin-2-yl-2-sulfanylideneethyl)azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 20545038) has the molecular formula C36H29N4O5PS and a molecular weight of 660.69 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[2-oxo-4-(2-pyrimidin-2-yl-2-sulfanylideneethyl)azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | (4-nitrophenyl)methyl 2-[2-oxo-4-(2-pyrimidin-2-yl-2-sulfanylideneethyl)azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 20545038 |
| Molecular Formula | C36H29N4O5PS |
| Molecular Weight | 660.69 g/mol |
| Exact Mass | 660.16 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[2-oxo-4-(2-pyrimidin-2-yl-2-sulfanylideneethyl)azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)C(N1C(=O)CC1CC(=S)c1ncccn1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H29N4O5PS/c41-33-24-28(23-32(47)34-37-21-10-22-38-34)39(33)35(36(42)45-25-26-17-19-27(20-18-26)40(43)44)46(29-11-4-1-5-12-29,30-13-6-2-7-14-30)31-15-8-3-9-16-31/h1-22,28H,23-25H2 |
| InChIKey | OOHVDKGFBBUYGX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 115.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.69 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|