C39H34N3O6PS — CID 88697184
(4-nitrophenyl)methyl 2-[(2S)-2-[3-(dimethylamino)benzoyl]sulfanyl-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 88697184) has the molecular formula C39H34N3O6PS and a molecular weight of 703.76 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(2S)-2-[3-(dimethylamino)benzoyl]sulfanyl-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | (4-nitrophenyl)methyl 2-[(2S)-2-[3-(dimethylamino)benzoyl]sulfanyl-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 88697184 |
| Molecular Formula | C39H34N3O6PS |
| Molecular Weight | 703.76 g/mol |
| Exact Mass | 703.19 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(2S)-2-[3-(dimethylamino)benzoyl]sulfanyl-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | CN(C)c1cccc(C(=O)S[C@H]2CC(=O)N2C(C(=O)OCc2ccc([N+](=O)[O-])cc2)=P(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C39H34N3O6PS/c1-40(2)31-14-12-13-29(25-31)39(45)50-36-26-35(43)41(36)37(38(44)48-27-28-21-23-30(24-22-28)42(46)47)49(32-15-6-3-7-16-32,33-17-8-4-9-18-33)34-19-10-5-11-20-34/h3-25,36H,26-27H2,1-2H3/t36-/m0/s1 |
| InChIKey | ZHHJDYCKKCCJBE-BHVANESWSA-N |
| XLogP | 5.96 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.76 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|