C39H29N2O8PS — CID 88738417
2-[1-[2-[(4-nitrophenyl)methoxy]-2-oxo-1-(triphenyl-λ5-phosphanylidene)ethyl]-4-oxoazetidin-2-yl]sulfanyl-1-benzofuran-4-carboxylic acid (PubChem CID 88738417) has the molecular formula C39H29N2O8PS and a molecular weight of 716.71 g/mol. Its IUPAC name is 2-[1-[2-[(4-nitrophenyl)methoxy]-2-oxo-1-(triphenyl-λ5-phosphanylidene)ethyl]-4-oxoazetidin-2-yl]sulfanyl-1-benzofuran-4-carboxylic acid.
| Compound Name | 2-[1-[2-[(4-nitrophenyl)methoxy]-2-oxo-1-(triphenyl-λ5-phosphanylidene)ethyl]-4-oxoazetidin-2-yl]sulfanyl-1-benzofuran-4-carboxylic acid |
|---|---|
| PubChem CID | 88738417 |
| Molecular Formula | C39H29N2O8PS |
| Molecular Weight | 716.71 g/mol |
| Exact Mass | 716.14 |
| IUPAC Name | 2-[1-[2-[(4-nitrophenyl)methoxy]-2-oxo-1-(triphenyl-λ5-phosphanylidene)ethyl]-4-oxoazetidin-2-yl]sulfanyl-1-benzofuran-4-carboxylic acid |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)C(N1C(=O)CC1Sc1cc2c(C(=O)O)cccc2o1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H29N2O8PS/c42-34-24-35(51-36-23-32-31(38(43)44)17-10-18-33(32)49-36)40(34)37(39(45)48-25-26-19-21-27(22-20-26)41(46)47)50(28-11-4-1-5-12-28,29-13-6-2-7-14-29)30-15-8-3-9-16-30/h1-23,35H,24-25H2,(H,43,44) |
| InChIKey | BHTQSTVNRMXKGQ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 140.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.71 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|