C21H17N3O6S3 — CID 88786464
(4-nitrophenyl)methyl (E)-2-[(2R)-2-(1,3-benzothiazol-4-yldisulfanyl)-4-oxoazetidin-1-yl]-3-hydroxybut-2-enoate (PubChem CID 88786464) has the molecular formula C21H17N3O6S3 and a molecular weight of 503.58 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (E)-2-[(2R)-2-(1,3-benzothiazol-4-yldisulfanyl)-4-oxoazetidin-1-yl]-3-hydroxybut-2-enoate.
| Compound Name | (4-nitrophenyl)methyl (E)-2-[(2R)-2-(1,3-benzothiazol-4-yldisulfanyl)-4-oxoazetidin-1-yl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 88786464 |
| Molecular Formula | C21H17N3O6S3 |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | (4-nitrophenyl)methyl (E)-2-[(2R)-2-(1,3-benzothiazol-4-yldisulfanyl)-4-oxoazetidin-1-yl]-3-hydroxybut-2-enoate |
| SMILES | C/C(O)=C(/C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)C[C@H]1SSc1cccc2scnc12 |
| InChI | InChI=1S/C21H17N3O6S3/c1-12(25)20(21(27)30-10-13-5-7-14(8-6-13)24(28)29)23-17(26)9-18(23)33-32-16-4-2-3-15-19(16)22-11-31-15/h2-8,11,18,25H,9-10H2,1H3/b20-12+/t18-/m1/s1 |
| InChIKey | UYOYXKULCRVVLA-BAOGCXAUSA-N |
| XLogP | 5.04 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|