C22H32N3O6S+ — CID 54721364
triethyl-[1-[(E)-3-hydroxy-5-methylsulfanyl-1-[(4-nitrophenyl)methoxy]-1-oxopent-2-en-2-yl]-4-oxoazetidin-2-yl]azanium (PubChem CID 54721364) has the molecular formula C22H32N3O6S+ and a molecular weight of 466.58 g/mol. Its IUPAC name is triethyl-[1-[(E)-3-hydroxy-5-methylsulfanyl-1-[(4-nitrophenyl)methoxy]-1-oxopent-2-en-2-yl]-4-oxoazetidin-2-yl]azanium.
| Compound Name | triethyl-[1-[(E)-3-hydroxy-5-methylsulfanyl-1-[(4-nitrophenyl)methoxy]-1-oxopent-2-en-2-yl]-4-oxoazetidin-2-yl]azanium |
|---|---|
| PubChem CID | 54721364 |
| Molecular Formula | C22H32N3O6S+ |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | triethyl-[1-[(E)-3-hydroxy-5-methylsulfanyl-1-[(4-nitrophenyl)methoxy]-1-oxopent-2-en-2-yl]-4-oxoazetidin-2-yl]azanium |
| SMILES | CC[N+](CC)(CC)C1CC(=O)N1/C(C(=O)OCc1ccc([N+](=O)[O-])cc1)=C(/O)CCSC |
| InChI | InChI=1S/C22H31N3O6S/c1-5-25(6-2,7-3)19-14-20(27)23(19)21(18(26)12-13-32-4)22(28)31-15-16-8-10-17(11-9-16)24(29)30/h8-11,19H,5-7,12-15H2,1-4H3/p+1 |
| InChIKey | APDXUZJMYCXQEA-UHFFFAOYSA-O |
| XLogP | 3.60 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|