C14H14N2O5S2 — CID 139039887
(4-nitrophenyl)methyl (2R,3R,5S)-3-methylsulfanyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 139039887) has the molecular formula C14H14N2O5S2 and a molecular weight of 354.41 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R,3R,5S)-3-methylsulfanyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2R,3R,5S)-3-methylsulfanyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 139039887 |
| Molecular Formula | C14H14N2O5S2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | (4-nitrophenyl)methyl (2R,3R,5S)-3-methylsulfanyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CS[C@@H]1S[C@H]2CC(=O)N2[C@@H]1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H14N2O5S2/c1-22-14-12(15-10(17)6-11(15)23-14)13(18)21-7-8-2-4-9(5-3-8)16(19)20/h2-5,11-12,14H,6-7H2,1H3/t11-,12+,14+/m0/s1 |
| InChIKey | JBRWDXLJKQXDAS-OUCADQQQSA-N |
| XLogP | 2.00 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|