C16H15N3O5S2 — CID 14165976
(4-nitrophenyl)methyl (2S,3R,5R)-3-methyl-7-oxo-3-(thiocyanatomethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 14165976) has the molecular formula C16H15N3O5S2 and a molecular weight of 393.45 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,3R,5R)-3-methyl-7-oxo-3-(thiocyanatomethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,3R,5R)-3-methyl-7-oxo-3-(thiocyanatomethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 14165976 |
| Molecular Formula | C16H15N3O5S2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,3R,5R)-3-methyl-7-oxo-3-(thiocyanatomethyl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@@]1(CSC#N)S[C@@H]2CC(=O)N2[C@H]1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H15N3O5S2/c1-16(8-25-9-17)14(18-12(20)6-13(18)26-16)15(21)24-7-10-2-4-11(5-3-10)19(22)23/h2-5,13-14H,6-8H2,1H3/t13-,14+,16+/m1/s1 |
| InChIKey | HQDKEDRAMIDFEM-YCPHGPKFSA-N |
| XLogP | 2.28 |
| TPSA | 113.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|