C23H22N6O6S2 — CID 88664828
(4-nitrophenyl)methyl 3-[[5-(4-methoxyphenyl)tetrazol-5-yl]sulfanylmethyl]-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88664828) has the molecular formula C23H22N6O6S2 and a molecular weight of 542.60 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-[[5-(4-methoxyphenyl)tetrazol-5-yl]sulfanylmethyl]-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 3-[[5-(4-methoxyphenyl)tetrazol-5-yl]sulfanylmethyl]-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88664828 |
| Molecular Formula | C23H22N6O6S2 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | (4-nitrophenyl)methyl 3-[[5-(4-methoxyphenyl)tetrazol-5-yl]sulfanylmethyl]-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COc1ccc(C2(SCC3(C)SC4CC(=O)N4C3C(=O)OCc3ccc([N+](=O)[O-])cc3)N=NN=N2)cc1 |
| InChI | InChI=1S/C23H22N6O6S2/c1-22(13-36-23(24-26-27-25-23)15-5-9-17(34-2)10-6-15)20(28-18(30)11-19(28)37-22)21(31)35-12-14-3-7-16(8-4-14)29(32)33/h3-10,19-20H,11-13H2,1-2H3 |
| InChIKey | QMDOMOOJAQTDBF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 148.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|