C19H19N5O7S — CID 23048126
(4-nitrophenyl)methyl 3-[(5-methoxycarbonyltriazol-1-yl)methyl]-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 23048126) has the molecular formula C19H19N5O7S and a molecular weight of 461.46 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-[(5-methoxycarbonyltriazol-1-yl)methyl]-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 3-[(5-methoxycarbonyltriazol-1-yl)methyl]-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 23048126 |
| Molecular Formula | C19H19N5O7S |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | (4-nitrophenyl)methyl 3-[(5-methoxycarbonyltriazol-1-yl)methyl]-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COC(=O)c1cnnn1CC1(C)SC2CC(=O)N2C1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19N5O7S/c1-19(10-22-13(8-20-21-22)17(26)30-2)16(23-14(25)7-15(23)32-19)18(27)31-9-11-3-5-12(6-4-11)24(28)29/h3-6,8,15-16H,7,9-10H2,1-2H3 |
| InChIKey | SZLHFJBIDBIBDK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 146.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|