C21H21N5O11S — CID 67916173
dimethyl 2-[[(2S,3S,5R)-3-methyl-2-[(4-nitrophenyl)methoxycarbonyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptan-3-yl]methyl]triazole-4,5-dicarboxylate (PubChem CID 67916173) has the molecular formula C21H21N5O11S and a molecular weight of 551.49 g/mol. Its IUPAC name is dimethyl 2-[[(2S,3S,5R)-3-methyl-2-[(4-nitrophenyl)methoxycarbonyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptan-3-yl]methyl]triazole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[[(2S,3S,5R)-3-methyl-2-[(4-nitrophenyl)methoxycarbonyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptan-3-yl]methyl]triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 67916173 |
| Molecular Formula | C21H21N5O11S |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | dimethyl 2-[[(2S,3S,5R)-3-methyl-2-[(4-nitrophenyl)methoxycarbonyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptan-3-yl]methyl]triazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1nn(C[C@@]2(C)[C@H](C(=O)OCc3ccc([N+](=O)[O-])cc3)N3C(=O)C[C@H]3S2(=O)=O)nc1C(=O)OC |
| InChI | InChI=1S/C21H21N5O11S/c1-21(10-24-22-15(18(28)35-2)16(23-24)19(29)36-3)17(25-13(27)8-14(25)38(21,33)34)20(30)37-9-11-4-6-12(7-5-11)26(31)32/h4-7,14,17H,8-10H2,1-3H3/t14-,17+,21+/m1/s1 |
| InChIKey | HAZZAUPJCHKARM-FNXXIHLHSA-N |
| XLogP | -0.38 |
| TPSA | 207.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|