C29H25N5O7S — CID 70431194
(4-nitrophenyl)methyl (2S,3S,5R)-3-[(4,5-diphenyltriazol-1-yl)methyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70431194) has the molecular formula C29H25N5O7S and a molecular weight of 587.61 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,3S,5R)-3-[(4,5-diphenyltriazol-1-yl)methyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,3S,5R)-3-[(4,5-diphenyltriazol-1-yl)methyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70431194 |
| Molecular Formula | C29H25N5O7S |
| Molecular Weight | 587.61 g/mol |
| Exact Mass | 587.15 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,3S,5R)-3-[(4,5-diphenyltriazol-1-yl)methyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@]1(Cn2nnc(-c3ccccc3)c2-c2ccccc2)[C@H](C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)C[C@H]2S1(=O)=O |
| InChI | InChI=1S/C29H25N5O7S/c1-29(18-32-26(21-10-6-3-7-11-21)25(30-31-32)20-8-4-2-5-9-20)27(33-23(35)16-24(33)42(29,39)40)28(36)41-17-19-12-14-22(15-13-19)34(37)38/h2-15,24,27H,16-18H2,1H3/t24-,27+,29+/m1/s1 |
| InChIKey | NCVOUQVNASQUHQ-QXGAZULMSA-N |
| XLogP | 3.38 |
| TPSA | 154.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|