C16H15N3O7S2 — CID 88629525
(4-nitrophenyl)methyl (2S,3R,5S)-3-methyl-4,4,7-trioxo-3-(thiocyanatomethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88629525) has the molecular formula C16H15N3O7S2 and a molecular weight of 425.44 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,3R,5S)-3-methyl-4,4,7-trioxo-3-(thiocyanatomethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,3R,5S)-3-methyl-4,4,7-trioxo-3-(thiocyanatomethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88629525 |
| Molecular Formula | C16H15N3O7S2 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,3R,5S)-3-methyl-4,4,7-trioxo-3-(thiocyanatomethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@]1(CSC#N)[C@H](C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)C[C@@H]2S1(=O)=O |
| InChI | InChI=1S/C16H15N3O7S2/c1-16(8-27-9-17)14(18-12(20)6-13(18)28(16,24)25)15(21)26-7-10-2-4-11(5-3-10)19(22)23/h2-5,13-14H,6-8H2,1H3/t13-,14-,16-/m0/s1 |
| InChIKey | LOUCLMFFKBAWEG-DZKIICNBSA-N |
| XLogP | 0.97 |
| TPSA | 147.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|