C21H21N5O9S — CID 70431028
(4-nitrophenyl)methyl (2S,3S,5S)-3-methyl-4,4,7-trioxo-3-[(5-prop-2-enoxycarbonyltriazol-1-yl)methyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70431028) has the molecular formula C21H21N5O9S and a molecular weight of 519.49 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,3S,5S)-3-methyl-4,4,7-trioxo-3-[(5-prop-2-enoxycarbonyltriazol-1-yl)methyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,3S,5S)-3-methyl-4,4,7-trioxo-3-[(5-prop-2-enoxycarbonyltriazol-1-yl)methyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70431028 |
| Molecular Formula | C21H21N5O9S |
| Molecular Weight | 519.49 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,3S,5S)-3-methyl-4,4,7-trioxo-3-[(5-prop-2-enoxycarbonyltriazol-1-yl)methyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C=CCOC(=O)c1cnnn1C[C@@]1(C)[C@H](C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)C[C@@H]2S1(=O)=O |
| InChI | InChI=1S/C21H21N5O9S/c1-3-8-34-19(28)15-10-22-23-24(15)12-21(2)18(25-16(27)9-17(25)36(21,32)33)20(29)35-11-13-4-6-14(7-5-13)26(30)31/h3-7,10,17-18H,1,8-9,11-12H2,2H3/t17-,18-,21-/m0/s1 |
| InChIKey | YRIVYLNMRPAUOM-WFXMLNOXSA-N |
| XLogP | 0.39 |
| TPSA | 180.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.49 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|