C18H20N2O8S — CID 10093822
(4-nitrophenyl)methyl (2S,5R,6R)-3,3-dimethyl-4,4,7-trioxo-6-(2-oxopropyl)-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 10093822) has the molecular formula C18H20N2O8S and a molecular weight of 424.43 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,5R,6R)-3,3-dimethyl-4,4,7-trioxo-6-(2-oxopropyl)-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,5R,6R)-3,3-dimethyl-4,4,7-trioxo-6-(2-oxopropyl)-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 10093822 |
| Molecular Formula | C18H20N2O8S |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,5R,6R)-3,3-dimethyl-4,4,7-trioxo-6-(2-oxopropyl)-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(=O)C[C@@H]1C(=O)N2[C@@H](C(=O)OCc3ccc([N+](=O)[O-])cc3)C(C)(C)S(=O)(=O)[C@H]12 |
| InChI | InChI=1S/C18H20N2O8S/c1-10(21)8-13-15(22)19-14(18(2,3)29(26,27)16(13)19)17(23)28-9-11-4-6-12(7-5-11)20(24)25/h4-7,13-14,16H,8-9H2,1-3H3/t13-,14+,16-/m1/s1 |
| InChIKey | NVNKYMRRNDIRPH-IJEWVQPXSA-N |
| XLogP | 0.98 |
| TPSA | 140.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|