C27H30N2O9S — CID 70469221
benzyl (2S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-6-[[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]oxymethyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70469221) has the molecular formula C27H30N2O9S and a molecular weight of 558.61 g/mol. Its IUPAC name is benzyl (2S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-6-[[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]oxymethyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (2S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-6-[[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]oxymethyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70469221 |
| Molecular Formula | C27H30N2O9S |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | benzyl (2S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-6-[[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]oxymethyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@@H](NC(=O)OCc1ccccc1)C(=O)OC[C@H]1C(=O)N2[C@@H](C(=O)OCc3ccccc3)C(C)(C)S(=O)(=O)[C@H]12 |
| InChI | InChI=1S/C27H30N2O9S/c1-17(28-26(33)38-15-19-12-8-5-9-13-19)24(31)37-16-20-22(30)29-21(27(2,3)39(34,35)23(20)29)25(32)36-14-18-10-6-4-7-11-18/h4-13,17,20-21,23H,14-16H2,1-3H3,(H,28,33)/t17-,20+,21+,23-/m1/s1 |
| InChIKey | HJRUQUXVGMYCAD-SPAWWWTRSA-N |
| XLogP | 1.95 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|