C23H30N2O10S — CID 70569775
1-butoxycarbonyloxyethyl (2S,5R)-3,3-dimethyl-4,4,7-trioxo-6-(phenylmethoxycarbonylamino)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70569775) has the molecular formula C23H30N2O10S and a molecular weight of 526.56 g/mol. Its IUPAC name is 1-butoxycarbonyloxyethyl (2S,5R)-3,3-dimethyl-4,4,7-trioxo-6-(phenylmethoxycarbonylamino)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 1-butoxycarbonyloxyethyl (2S,5R)-3,3-dimethyl-4,4,7-trioxo-6-(phenylmethoxycarbonylamino)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70569775 |
| Molecular Formula | C23H30N2O10S |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 1-butoxycarbonyloxyethyl (2S,5R)-3,3-dimethyl-4,4,7-trioxo-6-(phenylmethoxycarbonylamino)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CCCCOC(=O)OC(C)OC(=O)[C@@H]1N2C(=O)C(NC(=O)OCc3ccccc3)[C@H]2S(=O)(=O)C1(C)C |
| InChI | InChI=1S/C23H30N2O10S/c1-5-6-12-32-22(29)35-14(2)34-20(27)17-23(3,4)36(30,31)19-16(18(26)25(17)19)24-21(28)33-13-15-10-8-7-9-11-15/h7-11,14,16-17,19H,5-6,12-13H2,1-4H3,(H,24,28)/t14?,16?,17-,19+/m0/s1 |
| InChIKey | AJBZCILEOJRDAN-HJRFIPHPSA-N |
| XLogP | 1.87 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|