C24H32N2O9S — CID 70566196
1-hexanoyloxyethyl (2S,5R)-3,3-dimethyl-4,4,7-trioxo-6-(phenylmethoxycarbonylamino)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70566196) has the molecular formula C24H32N2O9S and a molecular weight of 524.59 g/mol. Its IUPAC name is 1-hexanoyloxyethyl (2S,5R)-3,3-dimethyl-4,4,7-trioxo-6-(phenylmethoxycarbonylamino)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 1-hexanoyloxyethyl (2S,5R)-3,3-dimethyl-4,4,7-trioxo-6-(phenylmethoxycarbonylamino)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70566196 |
| Molecular Formula | C24H32N2O9S |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 1-hexanoyloxyethyl (2S,5R)-3,3-dimethyl-4,4,7-trioxo-6-(phenylmethoxycarbonylamino)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CCCCCC(=O)OC(C)OC(=O)[C@@H]1N2C(=O)C(NC(=O)OCc3ccccc3)[C@H]2S(=O)(=O)C1(C)C |
| InChI | InChI=1S/C24H32N2O9S/c1-5-6-8-13-17(27)34-15(2)35-22(29)19-24(3,4)36(31,32)21-18(20(28)26(19)21)25-23(30)33-14-16-11-9-7-10-12-16/h7,9-12,15,18-19,21H,5-6,8,13-14H2,1-4H3,(H,25,30)/t15?,18?,19-,21+/m0/s1 |
| InChIKey | SGXIPPGDGGZXRN-ZZMNMLSYSA-N |
| XLogP | 2.04 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|