C24H26N2O7S — CID 13270147
benzyl (2S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-6-(phenylmethoxycarbonylaminomethyl)-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 13270147) has the molecular formula C24H26N2O7S and a molecular weight of 486.55 g/mol. Its IUPAC name is benzyl (2S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-6-(phenylmethoxycarbonylaminomethyl)-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (2S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-6-(phenylmethoxycarbonylaminomethyl)-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 13270147 |
| Molecular Formula | C24H26N2O7S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | benzyl (2S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-6-(phenylmethoxycarbonylaminomethyl)-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)OCc2ccccc2)N2C(=O)[C@H](CNC(=O)OCc3ccccc3)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C24H26N2O7S/c1-24(2)19(22(28)32-14-16-9-5-3-6-10-16)26-20(27)18(21(26)34(24,30)31)13-25-23(29)33-15-17-11-7-4-8-12-17/h3-12,18-19,21H,13-15H2,1-2H3,(H,25,29)/t18-,19-,21+/m0/s1 |
| InChIKey | JRBDJSGXBMYJQT-IRFCIJBXSA-N |
| XLogP | 2.02 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |