C17H18F3NO8S2 — CID 88688914
benzyl (2S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-6-(trifluoromethylsulfonyloxymethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88688914) has the molecular formula C17H18F3NO8S2 and a molecular weight of 485.46 g/mol. Its IUPAC name is benzyl (2S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-6-(trifluoromethylsulfonyloxymethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (2S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-6-(trifluoromethylsulfonyloxymethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88688914 |
| Molecular Formula | C17H18F3NO8S2 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | benzyl (2S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-6-(trifluoromethylsulfonyloxymethyl)-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)OCc2ccccc2)N2C(=O)[C@H](COS(=O)(=O)C(F)(F)F)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C17H18F3NO8S2/c1-16(2)12(15(23)28-8-10-6-4-3-5-7-10)21-13(22)11(14(21)30(16,24)25)9-29-31(26,27)17(18,19)20/h3-7,11-12,14H,8-9H2,1-2H3/t11-,12-,14+/m0/s1 |
| InChIKey | WOMCXSDDEGSAIF-SGMGOOAPSA-N |
| XLogP | 0.96 |
| TPSA | 124.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|