C17H21BrN2O6S — CID 88683489
benzyl (2S,5R,6R)-6-bromo-6-[(methoxyamino)methyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88683489) has the molecular formula C17H21BrN2O6S and a molecular weight of 461.33 g/mol. Its IUPAC name is benzyl (2S,5R,6R)-6-bromo-6-[(methoxyamino)methyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (2S,5R,6R)-6-bromo-6-[(methoxyamino)methyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88683489 |
| Molecular Formula | C17H21BrN2O6S |
| Molecular Weight | 461.33 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | benzyl (2S,5R,6R)-6-bromo-6-[(methoxyamino)methyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CONC[C@@]1(Br)C(=O)N2[C@@H](C(=O)OCc3ccccc3)C(C)(C)S(=O)(=O)[C@@H]21 |
| InChI | InChI=1S/C17H21BrN2O6S/c1-16(2)12(13(21)26-9-11-7-5-4-6-8-11)20-14(22)17(18,10-19-25-3)15(20)27(16,23)24/h4-8,12,15,19H,9-10H2,1-3H3/t12-,15+,17+/m0/s1 |
| InChIKey | ZQXQPTLVKQOENH-XGWLTEMNSA-N |
| XLogP | 0.76 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|