C23H25BrN2O6S — CID 88686102
benzyl (2S,5R,6R)-6-bromo-3,3-dimethyl-4,4,7-trioxo-6-[(phenylmethoxyamino)methyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88686102) has the molecular formula C23H25BrN2O6S and a molecular weight of 537.43 g/mol. Its IUPAC name is benzyl (2S,5R,6R)-6-bromo-3,3-dimethyl-4,4,7-trioxo-6-[(phenylmethoxyamino)methyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (2S,5R,6R)-6-bromo-3,3-dimethyl-4,4,7-trioxo-6-[(phenylmethoxyamino)methyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88686102 |
| Molecular Formula | C23H25BrN2O6S |
| Molecular Weight | 537.43 g/mol |
| Exact Mass | 536.06 |
| IUPAC Name | benzyl (2S,5R,6R)-6-bromo-3,3-dimethyl-4,4,7-trioxo-6-[(phenylmethoxyamino)methyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)OCc2ccccc2)N2C(=O)[C@](Br)(CNOCc3ccccc3)[C@H]2S1(=O)=O |
| InChI | InChI=1S/C23H25BrN2O6S/c1-22(2)18(19(27)31-13-16-9-5-3-6-10-16)26-20(28)23(24,21(26)33(22,29)30)15-25-32-14-17-11-7-4-8-12-17/h3-12,18,21,25H,13-15H2,1-2H3/t18-,21+,23+/m0/s1 |
| InChIKey | MQLHBRKPIHRVKL-QTGUNEKASA-N |
| XLogP | 2.33 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|