C25H28N2O7S — CID 70464246
benzyl (2S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-6-[(1S)-1-(phenylmethoxycarbonylamino)ethyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70464246) has the molecular formula C25H28N2O7S and a molecular weight of 500.57 g/mol. Its IUPAC name is benzyl (2S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-6-[(1S)-1-(phenylmethoxycarbonylamino)ethyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (2S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-6-[(1S)-1-(phenylmethoxycarbonylamino)ethyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70464246 |
| Molecular Formula | C25H28N2O7S |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | benzyl (2S,5R,6S)-3,3-dimethyl-4,4,7-trioxo-6-[(1S)-1-(phenylmethoxycarbonylamino)ethyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)[C@H]1C(=O)N2[C@@H](C(=O)OCc3ccccc3)C(C)(C)S(=O)(=O)[C@H]12 |
| InChI | InChI=1S/C25H28N2O7S/c1-16(26-24(30)34-15-18-12-8-5-9-13-18)19-21(28)27-20(25(2,3)35(31,32)22(19)27)23(29)33-14-17-10-6-4-7-11-17/h4-13,16,19-20,22H,14-15H2,1-3H3,(H,26,30)/t16-,19-,20-,22+/m0/s1 |
| InChIKey | JIOBDSVCDIAJKE-RAWXMELESA-N |
| XLogP | 2.40 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |