C20H26N2O7S — CID 70469754
benzyl (2S,5R,6R)-6-[[2-(dimethylamino)acetyl]oxymethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70469754) has the molecular formula C20H26N2O7S and a molecular weight of 438.50 g/mol. Its IUPAC name is benzyl (2S,5R,6R)-6-[[2-(dimethylamino)acetyl]oxymethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (2S,5R,6R)-6-[[2-(dimethylamino)acetyl]oxymethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70469754 |
| Molecular Formula | C20H26N2O7S |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | benzyl (2S,5R,6R)-6-[[2-(dimethylamino)acetyl]oxymethyl]-3,3-dimethyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CN(C)CC(=O)OC[C@@H]1C(=O)N2[C@@H](C(=O)OCc3ccccc3)C(C)(C)S(=O)(=O)[C@H]12 |
| InChI | InChI=1S/C20H26N2O7S/c1-20(2)16(19(25)29-11-13-8-6-5-7-9-13)22-17(24)14(18(22)30(20,26)27)12-28-15(23)10-21(3)4/h5-9,14,16,18H,10-12H2,1-4H3/t14-,16+,18-/m1/s1 |
| InChIKey | MKWDAUCEHIMGGR-UWWQBHOKSA-N |
| XLogP | 0.19 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |